C23H19N5O4S — CID 2617697
N-(2-methoxydibenzofuran-3-yl)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 2617697) has the molecular formula C23H19N5O4S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-(2-methoxydibenzofuran-3-yl)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2-methoxydibenzofuran-3-yl)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2617697 |
| Molecular Formula | C23H19N5O4S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N-(2-methoxydibenzofuran-3-yl)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)Nc2cc3oc4ccccc4c3cc2OC)cc1 |
| InChI | InChI=1S/C23H19N5O4S/c1-30-15-9-7-14(8-10-15)28-23(25-26-27-28)33-13-22(29)24-18-12-20-17(11-21(18)31-2)16-5-3-4-6-19(16)32-20/h3-12H,13H2,1-2H3,(H,24,29) |
| InChIKey | HCIQEKKNEBBDRB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |