C16H11ClF2N2OS — CID 39005978
1-(4-chlorophenyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylethanone (PubChem CID 39005978) has the molecular formula C16H11ClF2N2OS and a molecular weight of 352.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylethanone.
| Compound Name | 1-(4-chlorophenyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 39005978 |
| Molecular Formula | C16H11ClF2N2OS |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylethanone |
| SMILES | O=C(CSc1nc2ccccc2n1C(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11ClF2N2OS/c17-11-7-5-10(6-8-11)14(22)9-23-16-20-12-3-1-2-4-13(12)21(16)15(18)19/h1-8,15H,9H2 |
| InChIKey | BGYSMCIZLIUGNL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |