C18H17F2N3OS — CID 51261747
2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(1-phenylethyl)acetamide (PubChem CID 51261747) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 51261747 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanyl-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CSc1nc2ccccc2n1C(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H17F2N3OS/c1-12(13-7-3-2-4-8-13)21-16(24)11-25-18-22-14-9-5-6-10-15(14)23(18)17(19)20/h2-10,12,17H,11H2,1H3,(H,21,24) |
| InChIKey | HZRHIPJYEKVQTJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |