C16H19F2N3O3S — CID 51280111
ethyl 4-[[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]amino]butanoate (PubChem CID 51280111) has the molecular formula C16H19F2N3O3S and a molecular weight of 371.41 g/mol. Its IUPAC name is ethyl 4-[[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]amino]butanoate |
|---|---|
| PubChem CID | 51280111 |
| Molecular Formula | C16H19F2N3O3S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | ethyl 4-[[2-[1-(difluoromethyl)benzimidazol-2-yl]sulfanylacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)CSc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C16H19F2N3O3S/c1-2-24-14(23)8-5-9-19-13(22)10-25-16-20-11-6-3-4-7-12(11)21(16)15(17)18/h3-4,6-7,15H,2,5,8-10H2,1H3,(H,19,22) |
| InChIKey | ZYLHZIMAIPMCGZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|