C19H26N2O4S — CID 69316806
2-[2-(4-ethoxy-4-oxobutyl)sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69316806) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 2-[2-(4-ethoxy-4-oxobutyl)sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[2-(4-ethoxy-4-oxobutyl)sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69316806 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[2-(4-ethoxy-4-oxobutyl)sulfanylbenzimidazol-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | CCOC(=O)CCCSc1nc2ccccc2n1C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O4S/c1-5-25-15(22)11-8-12-26-18-20-13-9-6-7-10-14(13)21(18)16(17(23)24)19(2,3)4/h6-7,9-10,16H,5,8,11-12H2,1-4H3,(H,23,24) |
| InChIKey | IZYKUXGUFKPJGL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|