C22H26N4O3S — CID 69314945
3,3-dimethyl-2-[2-[2-(phenylcarbamoylamino)ethylsulfanyl]benzimidazol-1-yl]butanoic acid (PubChem CID 69314945) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-[2-(phenylcarbamoylamino)ethylsulfanyl]benzimidazol-1-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[2-[2-(phenylcarbamoylamino)ethylsulfanyl]benzimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69314945 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3,3-dimethyl-2-[2-[2-(phenylcarbamoylamino)ethylsulfanyl]benzimidazol-1-yl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1c(SCCNC(=O)Nc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C22H26N4O3S/c1-22(2,3)18(19(27)28)26-17-12-8-7-11-16(17)25-21(26)30-14-13-23-20(29)24-15-9-5-4-6-10-15/h4-12,18H,13-14H2,1-3H3,(H,27,28)(H2,23,24,29) |
| InChIKey | FIDJFUSMAQVODC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|