C23H28N2O3S — CID 69319677
3,3-dimethyl-2-[2-(4-phenoxybutylsulfanyl)benzimidazol-1-yl]butanoic acid (PubChem CID 69319677) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-(4-phenoxybutylsulfanyl)benzimidazol-1-yl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[2-(4-phenoxybutylsulfanyl)benzimidazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69319677 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3,3-dimethyl-2-[2-(4-phenoxybutylsulfanyl)benzimidazol-1-yl]butanoic acid |
| SMILES | CC(C)(C)C(C(=O)O)n1c(SCCCCOc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C23H28N2O3S/c1-23(2,3)20(21(26)27)25-19-14-8-7-13-18(19)24-22(25)29-16-10-9-15-28-17-11-5-4-6-12-17/h4-8,11-14,20H,9-10,15-16H2,1-3H3,(H,26,27) |
| InChIKey | MAOUCDLKHSNHQY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|