C18H20N2O3S — CID 2772502
3-[2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]propane-1,2-diol (PubChem CID 2772502) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-[2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]propane-1,2-diol.
| Compound Name | 3-[2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 2772502 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[2-(2-phenoxyethylsulfanyl)benzimidazol-1-yl]propane-1,2-diol |
| SMILES | OCC(O)Cn1c(SCCOc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C18H20N2O3S/c21-13-14(22)12-20-17-9-5-4-8-16(17)19-18(20)24-11-10-23-15-6-2-1-3-7-15/h1-9,14,21-22H,10-13H2 |
| InChIKey | WMTAJYANIFOQQE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|