C17H14ClN2O3S- — CID 7000527
2-[2-[2-(4-chlorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate (PubChem CID 7000527) has the molecular formula C17H14ClN2O3S- and a molecular weight of 361.83 g/mol. Its IUPAC name is 2-[2-[2-(4-chlorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate.
| Compound Name | 2-[2-[2-(4-chlorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 7000527 |
| Molecular Formula | C17H14ClN2O3S- |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-[2-[2-(4-chlorophenoxy)ethylsulfanyl]benzimidazol-1-yl]acetate |
| SMILES | O=C([O-])Cn1c(SCCOc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-12-5-7-13(8-6-12)23-9-10-24-17-19-14-3-1-2-4-15(14)20(17)11-16(21)22/h1-8H,9-11H2,(H,21,22)/p-1 |
| InChIKey | MCFBGFJBJVSYJM-UHFFFAOYSA-M |
| XLogP | 2.61 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|