C18H17N2O3S- — CID 3686672
2-[1-[2-(4-methylphenoxy)ethyl]benzimidazol-2-yl]sulfanylacetate (PubChem CID 3686672) has the molecular formula C18H17N2O3S- and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[1-[2-(4-methylphenoxy)ethyl]benzimidazol-2-yl]sulfanylacetate.
| Compound Name | 2-[1-[2-(4-methylphenoxy)ethyl]benzimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 3686672 |
| Molecular Formula | C18H17N2O3S- |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-[1-[2-(4-methylphenoxy)ethyl]benzimidazol-2-yl]sulfanylacetate |
| SMILES | Cc1ccc(OCCn2c(SCC(=O)[O-])nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18N2O3S/c1-13-6-8-14(9-7-13)23-11-10-20-16-5-3-2-4-15(16)19-18(20)24-12-17(21)22/h2-9H,10-12H2,1H3,(H,21,22)/p-1 |
| InChIKey | VEQKRKNBWXIGHQ-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |