C14H19N3O2S — CID 29066144
2-[1-[3-(dimethylazaniumyl)propyl]benzimidazol-2-yl]sulfanylacetate (PubChem CID 29066144) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-[1-[3-(dimethylazaniumyl)propyl]benzimidazol-2-yl]sulfanylacetate.
| Compound Name | 2-[1-[3-(dimethylazaniumyl)propyl]benzimidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 29066144 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[1-[3-(dimethylazaniumyl)propyl]benzimidazol-2-yl]sulfanylacetate |
| SMILES | C[NH+](C)CCCn1c(SCC(=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C14H19N3O2S/c1-16(2)8-5-9-17-12-7-4-3-6-11(12)15-14(17)20-10-13(18)19/h3-4,6-7H,5,8-10H2,1-2H3,(H,18,19) |
| InChIKey | JHHKSWRJIXYHPL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |