C17H24N4O2S — CID 112774728
N-(ethylcarbamoyl)-2-(1-pentylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 112774728) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(ethylcarbamoyl)-2-(1-pentylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-(ethylcarbamoyl)-2-(1-pentylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 112774728 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(ethylcarbamoyl)-2-(1-pentylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCCCCn1c(SCC(=O)NC(=O)NCC)nc2ccccc21 |
| InChI | InChI=1S/C17H24N4O2S/c1-3-5-8-11-21-14-10-7-6-9-13(14)19-17(21)24-12-15(22)20-16(23)18-4-2/h6-7,9-10H,3-5,8,11-12H2,1-2H3,(H2,18,20,22,23) |
| InChIKey | TUKCHSPPGGSCGU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|