C21H26N4O2S — CID 3687181
N-[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide (PubChem CID 3687181) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3687181 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N-[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CCCCCCn1c(SCC(=O)NC(=O)c2cccn2C)nc2ccccc21 |
| InChI | InChI=1S/C21H26N4O2S/c1-3-4-5-8-14-25-17-11-7-6-10-16(17)22-21(25)28-15-19(26)23-20(27)18-12-9-13-24(18)2/h6-7,9-13H,3-5,8,14-15H2,1-2H3,(H,23,26,27) |
| InChIKey | AAVMIKSZUGGDQO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|