C22H26ClN3OS — CID 7173108
N-[(4-chlorophenyl)methyl]-2-(1-hexylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 7173108) has the molecular formula C22H26ClN3OS and a molecular weight of 415.99 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(1-hexylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(1-hexylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7173108 |
| Molecular Formula | C22H26ClN3OS |
| Molecular Weight | 415.99 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(1-hexylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCCCCCn1c(SCC(=O)NCc2ccc(Cl)cc2)nc2ccccc21 |
| InChI | InChI=1S/C22H26ClN3OS/c1-2-3-4-7-14-26-20-9-6-5-8-19(20)25-22(26)28-16-21(27)24-15-17-10-12-18(23)13-11-17/h5-6,8-13H,2-4,7,14-16H2,1H3,(H,24,27) |
| InChIKey | FFQZYSBNSPJQOP-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.99 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|