C23H20ClN3OS — CID 46347404
N-benzyl-2-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetamide (PubChem CID 46347404) has the molecular formula C23H20ClN3OS and a molecular weight of 421.95 g/mol. Its IUPAC name is N-benzyl-2-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-2-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46347404 |
| Molecular Formula | C23H20ClN3OS |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-benzyl-2-[1-[(3-chlorophenyl)methyl]benzimidazol-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nc2ccccc2n1Cc1cccc(Cl)c1)NCc1ccccc1 |
| InChI | InChI=1S/C23H20ClN3OS/c24-19-10-6-9-18(13-19)15-27-21-12-5-4-11-20(21)26-23(27)29-16-22(28)25-14-17-7-2-1-3-8-17/h1-13H,14-16H2,(H,25,28) |
| InChIKey | RZTLUIZAXGWCQE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |