C23H18Cl2N4OS — CID 3717247
2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,4-dichlorophenyl)methylideneamino]acetamide (PubChem CID 3717247) has the molecular formula C23H18Cl2N4OS and a molecular weight of 469.40 g/mol. Its IUPAC name is 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,4-dichlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3717247 |
| Molecular Formula | C23H18Cl2N4OS |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,4-dichlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nc2ccccc2n1Cc1ccccc1)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H18Cl2N4OS/c24-18-11-10-17(19(25)12-18)13-26-28-22(30)15-31-23-27-20-8-4-5-9-21(20)29(23)14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,28,30) |
| InChIKey | GNQPLSKMJCAPSS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|