C25H24N4O3S — CID 1354661
2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 1354661) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 1354661 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(C=NNC(=O)CSc2nc3ccccc3n2Cc2ccccc2)c1OC |
| InChI | InChI=1S/C25H24N4O3S/c1-31-22-14-8-11-19(24(22)32-2)15-26-28-23(30)17-33-25-27-20-12-6-7-13-21(20)29(25)16-18-9-4-3-5-10-18/h3-15H,16-17H2,1-2H3,(H,28,30) |
| InChIKey | PHYYLRFWYBSGHU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|