C27H28N4O4S — CID 6006785
2-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 6006785) has the molecular formula C27H28N4O4S and a molecular weight of 504.61 g/mol. Its IUPAC name is 2-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6006785 |
| Molecular Formula | C27H28N4O4S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 2-[1-[(4-methylphenyl)methyl]benzimidazol-2-yl]sulfanyl-N-[(Z)-(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(OC)c(/C=N\NC(=O)CSc2nc3ccccc3n2Cc2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C27H28N4O4S/c1-18-9-11-19(12-10-18)16-31-23-8-6-5-7-22(23)29-27(31)36-17-26(32)30-28-15-21-24(34-3)13-20(33-2)14-25(21)35-4/h5-15H,16-17H2,1-4H3,(H,30,32)/b28-15- |
| InChIKey | CMEHWIVFRPDDSM-MBTHVWNTSA-N |
| XLogP | 4.66 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|