C22H33N3OS — CID 7173080
2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 7173080) has the molecular formula C22H33N3OS and a molecular weight of 387.59 g/mol. Its IUPAC name is 2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7173080 |
| Molecular Formula | C22H33N3OS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(1-hexylbenzimidazol-2-yl)sulfanyl-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | CCCCCCn1c(SCC(=O)N[C@@H]2CCCC[C@H]2C)nc2ccccc21 |
| InChI | InChI=1S/C22H33N3OS/c1-3-4-5-10-15-25-20-14-9-8-13-19(20)24-22(25)27-16-21(26)23-18-12-7-6-11-17(18)2/h8-9,13-14,17-18H,3-7,10-12,15-16H2,1-2H3,(H,23,26)/t17-,18-/m1/s1 |
| InChIKey | BPXLKGSQYKPCIW-QZTJIDSGSA-N |
| XLogP | 5.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|