C22H31N3O3S — CID 2696328
2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(1S,2R)-2-methylcyclohexyl]acetamide (PubChem CID 2696328) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(1S,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 2696328 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[3-(3-ethoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
| SMILES | CCOCCCn1c(SCC(=O)N[C@H]2CCCC[C@H]2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H31N3O3S/c1-3-28-14-8-13-25-21(27)17-10-5-7-12-19(17)24-22(25)29-15-20(26)23-18-11-6-4-9-16(18)2/h5,7,10,12,16,18H,3-4,6,8-9,11,13-15H2,1-2H3,(H,23,26)/t16-,18+/m1/s1 |
| InChIKey | SGNHWNWOQYVDGD-AEFFLSMTSA-N |
| XLogP | 3.61 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|