C23H33N3O3S — CID 7738221
N-[(1R,2R)-2-methylcyclohexyl]-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 7738221) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7738221 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)OCCCn1c(SCC(=O)N[C@@H]2CCCC[C@H]2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H33N3O3S/c1-16(2)29-14-8-13-26-22(28)18-10-5-7-12-20(18)25-23(26)30-15-21(27)24-19-11-6-4-9-17(19)3/h5,7,10,12,16-17,19H,4,6,8-9,11,13-15H2,1-3H3,(H,24,27)/t17-,19-/m1/s1 |
| InChIKey | PZLIVDALCNXMIP-IEBWSBKVSA-N |
| XLogP | 4.00 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|