C24H27N3O2S — CID 7855356
2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(1S,2S)-2-methylcyclohexyl]acetamide (PubChem CID 7855356) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(1S,2S)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7855356 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-(3-benzyl-4-oxoquinazolin-2-yl)sulfanyl-N-[(1S,2S)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)CSc1nc2ccccc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-17-9-5-7-13-20(17)25-22(28)16-30-24-26-21-14-8-6-12-19(21)23(29)27(24)15-18-10-3-2-4-11-18/h2-4,6,8,10-12,14,17,20H,5,7,9,13,15-16H2,1H3,(H,25,28)/t17-,20-/m0/s1 |
| InChIKey | HMDLLBIPCLWYTL-PXNSSMCTSA-N |
| XLogP | 4.23 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |