C22H26N4O2S — CID 7173153
2-[[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]amino]benzamide (PubChem CID 7173153) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | 2-[[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 7173153 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[2-(1-hexylbenzimidazol-2-yl)sulfanylacetyl]amino]benzamide |
| SMILES | CCCCCCn1c(SCC(=O)Nc2ccccc2C(N)=O)nc2ccccc21 |
| InChI | InChI=1S/C22H26N4O2S/c1-2-3-4-9-14-26-19-13-8-7-12-18(19)25-22(26)29-15-20(27)24-17-11-6-5-10-16(17)21(23)28/h5-8,10-13H,2-4,9,14-15H2,1H3,(H2,23,28)(H,24,27) |
| InChIKey | VDZTVQLCWFCGDB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|