C21H24N4O5S2 — CID 7043281
methyl 2-[[2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 7043281) has the molecular formula C21H24N4O5S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is methyl 2-[[2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7043281 |
| Molecular Formula | C21H24N4O5S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | methyl 2-[[2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCCn1c(SCC(=O)Nc2ccccc2C(=O)OC)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C21H24N4O5S2/c1-3-4-11-25-18-10-9-14(32(22,28)29)12-17(18)24-21(25)31-13-19(26)23-16-8-6-5-7-15(16)20(27)30-2/h5-10,12H,3-4,11,13H2,1-2H3,(H,23,26)(H2,22,28,29) |
| InChIKey | WGZWXXWIXFXUNX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 133.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |