C19H20Cl2N4O3S2 — CID 4809467
2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,5-dichlorophenyl)acetamide (PubChem CID 4809467) has the molecular formula C19H20Cl2N4O3S2 and a molecular weight of 487.43 g/mol. Its IUPAC name is 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,5-dichlorophenyl)acetamide.
| Compound Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4809467 |
| Molecular Formula | C19H20Cl2N4O3S2 |
| Molecular Weight | 487.43 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,5-dichlorophenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2cc(Cl)ccc2Cl)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H20Cl2N4O3S2/c1-2-3-8-25-17-7-5-13(30(22,27)28)10-16(17)24-19(25)29-11-18(26)23-15-9-12(20)4-6-14(15)21/h4-7,9-10H,2-3,8,11H2,1H3,(H,23,26)(H2,22,27,28) |
| InChIKey | BMHFDNMISVYRFX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.43 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |