C19H20ClN3O3S2 — CID 25047932
1-butyl-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 25047932) has the molecular formula C19H20ClN3O3S2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 1-butyl-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-butyl-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 25047932 |
| Molecular Formula | C19H20ClN3O3S2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 1-butyl-2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCCCn1c(SCC(=O)c2ccc(Cl)cc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C19H20ClN3O3S2/c1-2-3-10-23-17-9-8-15(28(21,25)26)11-16(17)22-19(23)27-12-18(24)13-4-6-14(20)7-5-13/h4-9,11H,2-3,10,12H2,1H3,(H2,21,25,26) |
| InChIKey | RRKGZVLPVALAHF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |