C23H30N4O3S2 — CID 25039119
2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide (PubChem CID 25039119) has the molecular formula C23H30N4O3S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 25039119 |
| Molecular Formula | C23H30N4O3S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2c(CC)cccc2CC)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H30N4O3S2/c1-4-7-13-27-20-12-11-18(32(24,29)30)14-19(20)25-23(27)31-15-21(28)26-22-16(5-2)9-8-10-17(22)6-3/h8-12,14H,4-7,13,15H2,1-3H3,(H,26,28)(H2,24,29,30) |
| InChIKey | DMECIPSATPKOOI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |