C20H21N5O3S2 — CID 4852149
2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(3-cyanophenyl)acetamide (PubChem CID 4852149) has the molecular formula C20H21N5O3S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(3-cyanophenyl)acetamide.
| Compound Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(3-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 4852149 |
| Molecular Formula | C20H21N5O3S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(3-cyanophenyl)acetamide |
| SMILES | CCCCn1c(SCC(=O)Nc2cccc(C#N)c2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H21N5O3S2/c1-2-3-9-25-18-8-7-16(30(22,27)28)11-17(18)24-20(25)29-13-19(26)23-15-6-4-5-14(10-15)12-21/h4-8,10-11H,2-3,9,13H2,1H3,(H,23,26)(H2,22,27,28) |
| InChIKey | XEHDGVOXJRSBDI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |