C18H28N4O3S2 — CID 7839697
2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-pentan-2-yl]acetamide (PubChem CID 7839697) has the molecular formula C18H28N4O3S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-pentan-2-yl]acetamide.
| Compound Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 7839697 |
| Molecular Formula | C18H28N4O3S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(1-butyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-[(2R)-pentan-2-yl]acetamide |
| SMILES | CCCCn1c(SCC(=O)N[C@H](C)CCC)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C18H28N4O3S2/c1-4-6-10-22-16-9-8-14(27(19,24)25)11-15(16)21-18(22)26-12-17(23)20-13(3)7-5-2/h8-9,11,13H,4-7,10,12H2,1-3H3,(H,20,23)(H2,19,24,25)/t13-/m1/s1 |
| InChIKey | RBVOFAMJNOLVHP-CYBMUJFWSA-N |
| XLogP | 2.88 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |