C21H34N4O3S2 — CID 29180122
N-[(2R)-butan-2-yl]-2-[1-butyl-5-(diethylsulfamoyl)benzimidazol-2-yl]sulfanylacetamide (PubChem CID 29180122) has the molecular formula C21H34N4O3S2 and a molecular weight of 454.66 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[1-butyl-5-(diethylsulfamoyl)benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[1-butyl-5-(diethylsulfamoyl)benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 29180122 |
| Molecular Formula | C21H34N4O3S2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[1-butyl-5-(diethylsulfamoyl)benzimidazol-2-yl]sulfanylacetamide |
| SMILES | CCCCn1c(SCC(=O)N[C@H](C)CC)nc2cc(S(=O)(=O)N(CC)CC)ccc21 |
| InChI | InChI=1S/C21H34N4O3S2/c1-6-10-13-25-19-12-11-17(30(27,28)24(8-3)9-4)14-18(19)23-21(25)29-15-20(26)22-16(5)7-2/h11-12,14,16H,6-10,13,15H2,1-5H3,(H,22,26)/t16-/m1/s1 |
| InChIKey | YCOLCZHLDUYWPY-MRXNPFEDSA-N |
| XLogP | 3.87 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |