C18H28N4O3S2 — CID 4816472
2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-propan-2-ylacetamide (PubChem CID 4816472) has the molecular formula C18H28N4O3S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-propan-2-ylacetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 4816472 |
| Molecular Formula | C18H28N4O3S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-propan-2-ylacetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SCC(=O)NC(C)C)n2CC |
| InChI | InChI=1S/C18H28N4O3S2/c1-6-21(7-2)27(24,25)14-9-10-16-15(11-14)20-18(22(16)8-3)26-12-17(23)19-13(4)5/h9-11,13H,6-8,12H2,1-5H3,(H,19,23) |
| InChIKey | VDFYXSQXYJBAJW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |