C18H27N5O4S2 — CID 4816615
2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide (PubChem CID 4816615) has the molecular formula C18H27N5O4S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 4816615 |
| Molecular Formula | C18H27N5O4S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanyl-N-(methylcarbamoyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SC(C)C(=O)NC(=O)NC)n2CC |
| InChI | InChI=1S/C18H27N5O4S2/c1-6-22(7-2)29(26,27)13-9-10-15-14(11-13)20-18(23(15)8-3)28-12(4)16(24)21-17(25)19-5/h9-12H,6-8H2,1-5H3,(H2,19,21,24,25) |
| InChIKey | OMWUZABPRXCCBU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |