C17H25N3O4S2 — CID 42971502
methyl 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylpropanoate (PubChem CID 42971502) has the molecular formula C17H25N3O4S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is methyl 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylpropanoate.
| Compound Name | methyl 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 42971502 |
| Molecular Formula | C17H25N3O4S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | methyl 2-[5-(diethylsulfamoyl)-1-ethylbenzimidazol-2-yl]sulfanylpropanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)nc(SC(C)C(=O)OC)n2CC |
| InChI | InChI=1S/C17H25N3O4S2/c1-6-19(7-2)26(22,23)13-9-10-15-14(11-13)18-17(20(15)8-3)25-12(4)16(21)24-5/h9-12H,6-8H2,1-5H3 |
| InChIKey | QFTWZPAHLAJVDW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |