C20H22N4O4S2 — CID 42915937
N-[4-[2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylpropanoyl]phenyl]acetamide (PubChem CID 42915937) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[4-[2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylpropanoyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylpropanoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 42915937 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-[4-[2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanylpropanoyl]phenyl]acetamide |
| SMILES | CCn1c(SC(C)C(=O)c2ccc(NC(C)=O)cc2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C20H22N4O4S2/c1-4-24-18-10-9-16(30(21,27)28)11-17(18)23-20(24)29-12(2)19(26)14-5-7-15(8-6-14)22-13(3)25/h5-12H,4H2,1-3H3,(H,22,25)(H2,21,27,28) |
| InChIKey | QDEKOQRYABRHAG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |