C17H20N4O4S2 — CID 40657581
(2S)-2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(furan-2-ylmethyl)propanamide (PubChem CID 40657581) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is (2S)-2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(furan-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 40657581 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (2S)-2-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)sulfanyl-N-(furan-2-ylmethyl)propanamide |
| SMILES | CCn1c(S[C@@H](C)C(=O)NCc2ccco2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H20N4O4S2/c1-3-21-15-7-6-13(27(18,23)24)9-14(15)20-17(21)26-11(2)16(22)19-10-12-5-4-8-25-12/h4-9,11H,3,10H2,1-2H3,(H,19,22)(H2,18,23,24)/t11-/m0/s1 |
| InChIKey | WRWSRGBXLSAOSX-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |