C23H28N4O4S2 — CID 41156539
(2R)-N-benzyl-2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide (PubChem CID 41156539) has the molecular formula C23H28N4O4S2 and a molecular weight of 488.64 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-benzyl-2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 41156539 |
| Molecular Formula | C23H28N4O4S2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (2R)-N-benzyl-2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanylpropanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)NCc2ccccc2)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C23H28N4O4S2/c1-3-27-21-10-9-19(33(29,30)26-11-13-31-14-12-26)15-20(21)25-23(27)32-17(2)22(28)24-16-18-7-5-4-6-8-18/h4-10,15,17H,3,11-14,16H2,1-2H3,(H,24,28)/t17-/m1/s1 |
| InChIKey | ISLBCJAKGLZFJY-QGZVFWFLSA-N |
| XLogP | 2.87 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |