C20H30N4O4S2 — CID 16510150
2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanyl-N-pentan-3-ylacetamide (PubChem CID 16510150) has the molecular formula C20H30N4O4S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanyl-N-pentan-3-ylacetamide.
| Compound Name | 2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanyl-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 16510150 |
| Molecular Formula | C20H30N4O4S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-(1-ethyl-5-morpholin-4-ylsulfonylbenzimidazol-2-yl)sulfanyl-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CSc1nc2cc(S(=O)(=O)N3CCOCC3)ccc2n1CC |
| InChI | InChI=1S/C20H30N4O4S2/c1-4-15(5-2)21-19(25)14-29-20-22-17-13-16(7-8-18(17)24(20)6-3)30(26,27)23-9-11-28-12-10-23/h7-8,13,15H,4-6,9-12,14H2,1-3H3,(H,21,25) |
| InChIKey | QHHDDTQLMURSAF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |