C17H23N5O4S2 — CID 16514893
N-carbamoyl-2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 16514893) has the molecular formula C17H23N5O4S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is N-carbamoyl-2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-carbamoyl-2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 16514893 |
| Molecular Formula | C17H23N5O4S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-carbamoyl-2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(=O)NC(N)=O)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C17H23N5O4S2/c1-2-22-14-7-6-12(28(25,26)21-8-4-3-5-9-21)10-13(14)19-17(22)27-11-15(23)20-16(18)24/h6-7,10H,2-5,8-9,11H2,1H3,(H3,18,20,23,24) |
| InChIKey | DISBGSAYCYTKDN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |