C21H30N4O3S2 — CID 17449106
2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanyl-1-piperidin-1-ylethanone (PubChem CID 17449106) has the molecular formula C21H30N4O3S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanyl-1-piperidin-1-ylethanone.
| Compound Name | 2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanyl-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 17449106 |
| Molecular Formula | C21H30N4O3S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-(1-ethyl-5-piperidin-1-ylsulfonylbenzimidazol-2-yl)sulfanyl-1-piperidin-1-ylethanone |
| SMILES | CCn1c(SCC(=O)N2CCCCC2)nc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C21H30N4O3S2/c1-2-25-19-10-9-17(30(27,28)24-13-7-4-8-14-24)15-18(19)22-21(25)29-16-20(26)23-11-5-3-6-12-23/h9-10,15H,2-8,11-14,16H2,1H3 |
| InChIKey | AIAOVKICWSBIHB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |