C17H24N4O3S2 — CID 7488379
1-ethyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide (PubChem CID 7488379) has the molecular formula C17H24N4O3S2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide.
| Compound Name | 1-ethyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 7488379 |
| Molecular Formula | C17H24N4O3S2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 1-ethyl-2-[2-[(3S)-3-methylpiperidin-1-yl]-2-oxoethyl]sulfanylbenzimidazole-5-sulfonamide |
| SMILES | CCn1c(SCC(=O)N2CCC[C@H](C)C2)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C17H24N4O3S2/c1-3-21-15-7-6-13(26(18,23)24)9-14(15)19-17(21)25-11-16(22)20-8-4-5-12(2)10-20/h6-7,9,12H,3-5,8,10-11H2,1-2H3,(H2,18,23,24)/t12-/m0/s1 |
| InChIKey | ONZHDUPLPSIZOW-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |