C24H36N4O5S2 — CID 46097800
2-[1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone (PubChem CID 46097800) has the molecular formula C24H36N4O5S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 46097800 |
| Molecular Formula | C24H36N4O5S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 2-[1-(3-ethoxypropyl)-5-(3-methylpiperidin-1-yl)sulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone |
| SMILES | CCOCCCn1c(SCC(=O)N2CCOCC2)nc2cc(S(=O)(=O)N3CCCC(C)C3)ccc21 |
| InChI | InChI=1S/C24H36N4O5S2/c1-3-32-13-5-10-28-22-8-7-20(35(30,31)27-9-4-6-19(2)17-27)16-21(22)25-24(28)34-18-23(29)26-11-14-33-15-12-26/h7-8,16,19H,3-6,9-15,17-18H2,1-2H3 |
| InChIKey | CDDKICSJSPVGTR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|