C22H32N4O6S2 — CID 46097805
2-[1-(3-ethoxypropyl)-5-morpholin-4-ylsulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone (PubChem CID 46097805) has the molecular formula C22H32N4O6S2 and a molecular weight of 512.65 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropyl)-5-morpholin-4-ylsulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-(3-ethoxypropyl)-5-morpholin-4-ylsulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 46097805 |
| Molecular Formula | C22H32N4O6S2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 2-[1-(3-ethoxypropyl)-5-morpholin-4-ylsulfonylbenzimidazol-2-yl]sulfanyl-1-morpholin-4-ylethanone |
| SMILES | CCOCCCn1c(SCC(=O)N2CCOCC2)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C22H32N4O6S2/c1-2-30-11-3-6-26-20-5-4-18(34(28,29)25-9-14-32-15-10-25)16-19(20)23-22(26)33-17-21(27)24-7-12-31-13-8-24/h4-5,16H,2-3,6-15,17H2,1H3 |
| InChIKey | KEKHKWLCFIKGOY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|