C23H26F3N3O4S2 — CID 46096364
4-[1-(3-ethoxypropyl)-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine (PubChem CID 46096364) has the molecular formula C23H26F3N3O4S2 and a molecular weight of 529.61 g/mol. Its IUPAC name is 4-[1-(3-ethoxypropyl)-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine.
| Compound Name | 4-[1-(3-ethoxypropyl)-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 46096364 |
| Molecular Formula | C23H26F3N3O4S2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 4-[1-(3-ethoxypropyl)-2-[(2,3,4-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
| SMILES | CCOCCCn1c(SCc2ccc(F)c(F)c2F)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C23H26F3N3O4S2/c1-2-32-11-3-8-29-20-7-5-17(35(30,31)28-9-12-33-13-10-28)14-19(20)27-23(29)34-15-16-4-6-18(24)22(26)21(16)25/h4-7,14H,2-3,8-13,15H2,1H3 |
| InChIKey | KTPUMPAQTPOMTO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|