C23H27F2N3O4S2 — CID 46096398
4-[2-[(3,5-difluorophenyl)methylsulfanyl]-1-(3-ethoxypropyl)benzimidazol-5-yl]sulfonylmorpholine (PubChem CID 46096398) has the molecular formula C23H27F2N3O4S2 and a molecular weight of 511.62 g/mol. Its IUPAC name is 4-[2-[(3,5-difluorophenyl)methylsulfanyl]-1-(3-ethoxypropyl)benzimidazol-5-yl]sulfonylmorpholine.
| Compound Name | 4-[2-[(3,5-difluorophenyl)methylsulfanyl]-1-(3-ethoxypropyl)benzimidazol-5-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 46096398 |
| Molecular Formula | C23H27F2N3O4S2 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 4-[2-[(3,5-difluorophenyl)methylsulfanyl]-1-(3-ethoxypropyl)benzimidazol-5-yl]sulfonylmorpholine |
| SMILES | CCOCCCn1c(SCc2cc(F)cc(F)c2)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C23H27F2N3O4S2/c1-2-31-9-3-6-28-22-5-4-20(34(29,30)27-7-10-32-11-8-27)15-21(22)26-23(28)33-16-17-12-18(24)14-19(25)13-17/h4-5,12-15H,2-3,6-11,16H2,1H3 |
| InChIKey | XPACASOSGCKJDE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|