C25H29F3N4O4S2 — CID 46096125
4-[3-[5-morpholin-4-ylsulfonyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-1-yl]propyl]morpholine (PubChem CID 46096125) has the molecular formula C25H29F3N4O4S2 and a molecular weight of 570.66 g/mol. Its IUPAC name is 4-[3-[5-morpholin-4-ylsulfonyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[5-morpholin-4-ylsulfonyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 46096125 |
| Molecular Formula | C25H29F3N4O4S2 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 4-[3-[5-morpholin-4-ylsulfonyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-1-yl]propyl]morpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)nc(SCc1cc(F)c(F)cc1F)n2CCCN1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C25H29F3N4O4S2/c26-20-16-22(28)21(27)14-18(20)17-37-25-29-23-15-19(38(33,34)31-8-12-36-13-9-31)2-3-24(23)32(25)5-1-4-30-6-10-35-11-7-30/h2-3,14-16H,1,4-13,17H2 |
| InChIKey | HJRQKYXGSAYNDO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|