C23H24F3N3O4S2 — CID 98366380
4-[1-[[(2R)-oxolan-2-yl]methyl]-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine (PubChem CID 98366380) has the molecular formula C23H24F3N3O4S2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 4-[1-[[(2R)-oxolan-2-yl]methyl]-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine.
| Compound Name | 4-[1-[[(2R)-oxolan-2-yl]methyl]-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 98366380 |
| Molecular Formula | C23H24F3N3O4S2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 4-[1-[[(2R)-oxolan-2-yl]methyl]-2-[(2,3,6-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)nc(SCc1c(F)ccc(F)c1F)n2C[C@H]1CCCO1)N1CCOCC1 |
| InChI | InChI=1S/C23H24F3N3O4S2/c24-18-4-5-19(25)22(26)17(18)14-34-23-27-20-12-16(35(30,31)28-7-10-32-11-8-28)3-6-21(20)29(23)13-15-2-1-9-33-15/h3-6,12,15H,1-2,7-11,13-14H2/t15-/m1/s1 |
| InChIKey | BDKSINXJIXNHIS-OAHLLOKOSA-N |
| XLogP | 3.95 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|