C23H22F5N3O3S2 — CID 46096059
1-(oxolan-2-ylmethyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylbenzimidazole (PubChem CID 46096059) has the molecular formula C23H22F5N3O3S2 and a molecular weight of 547.57 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylbenzimidazole.
| Compound Name | 1-(oxolan-2-ylmethyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylbenzimidazole |
|---|---|
| PubChem CID | 46096059 |
| Molecular Formula | C23H22F5N3O3S2 |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-2-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-5-pyrrolidin-1-ylsulfonylbenzimidazole |
| SMILES | O=S(=O)(c1ccc2c(c1)nc(SCc1c(F)c(F)c(F)c(F)c1F)n2CC1CCCO1)N1CCCC1 |
| InChI | InChI=1S/C23H22F5N3O3S2/c24-18-15(19(25)21(27)22(28)20(18)26)12-35-23-29-16-10-14(36(32,33)30-7-1-2-8-30)5-6-17(16)31(23)11-13-4-3-9-34-13/h5-6,10,13H,1-4,7-9,11-12H2 |
| InChIKey | BBLANEYPQIFLLI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|