C23H23F4N3O3S2 — CID 98394189
1-[[(2R)-oxolan-2-yl]methyl]-5-pyrrolidin-1-ylsulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole (PubChem CID 98394189) has the molecular formula C23H23F4N3O3S2 and a molecular weight of 529.58 g/mol. Its IUPAC name is 1-[[(2R)-oxolan-2-yl]methyl]-5-pyrrolidin-1-ylsulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole.
| Compound Name | 1-[[(2R)-oxolan-2-yl]methyl]-5-pyrrolidin-1-ylsulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole |
|---|---|
| PubChem CID | 98394189 |
| Molecular Formula | C23H23F4N3O3S2 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | 1-[[(2R)-oxolan-2-yl]methyl]-5-pyrrolidin-1-ylsulfonyl-2-[(2,3,4,5-tetrafluorophenyl)methylsulfanyl]benzimidazole |
| SMILES | O=S(=O)(c1ccc2c(c1)nc(SCc1cc(F)c(F)c(F)c1F)n2C[C@H]1CCCO1)N1CCCC1 |
| InChI | InChI=1S/C23H23F4N3O3S2/c24-17-10-14(20(25)22(27)21(17)26)13-34-23-28-18-11-16(35(31,32)29-7-1-2-8-29)5-6-19(18)30(23)12-15-4-3-9-33-15/h5-6,10-11,15H,1-4,7-9,12-13H2/t15-/m1/s1 |
| InChIKey | UQEVJSGUYPSDGB-OAHLLOKOSA-N |
| XLogP | 4.85 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|