C21H22F3N3O3S2 — CID 46096144
4-[1-propyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine (PubChem CID 46096144) has the molecular formula C21H22F3N3O3S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 4-[1-propyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine.
| Compound Name | 4-[1-propyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 46096144 |
| Molecular Formula | C21H22F3N3O3S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 4-[1-propyl-2-[(2,4,5-trifluorophenyl)methylsulfanyl]benzimidazol-5-yl]sulfonylmorpholine |
| SMILES | CCCn1c(SCc2cc(F)c(F)cc2F)nc2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H22F3N3O3S2/c1-2-5-27-20-4-3-15(32(28,29)26-6-8-30-9-7-26)11-19(20)25-21(27)31-13-14-10-17(23)18(24)12-16(14)22/h3-4,10-12H,2,5-9,13H2,1H3 |
| InChIKey | XYOAHIWWBLEZIL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|