C26H34FN3O3S2 — CID 92773397
1-(3-ethoxypropyl)-2-[(3-fluoro-4-methylphenyl)methylsulfanyl]-5-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzimidazole (PubChem CID 92773397) has the molecular formula C26H34FN3O3S2 and a molecular weight of 519.71 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[(3-fluoro-4-methylphenyl)methylsulfanyl]-5-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzimidazole.
| Compound Name | 1-(3-ethoxypropyl)-2-[(3-fluoro-4-methylphenyl)methylsulfanyl]-5-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzimidazole |
|---|---|
| PubChem CID | 92773397 |
| Molecular Formula | C26H34FN3O3S2 |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[(3-fluoro-4-methylphenyl)methylsulfanyl]-5-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzimidazole |
| SMILES | CCOCCCn1c(SCc2ccc(C)c(F)c2)nc2cc(S(=O)(=O)N3CCC[C@@H](C)C3)ccc21 |
| InChI | InChI=1S/C26H34FN3O3S2/c1-4-33-14-6-13-30-25-11-10-22(35(31,32)29-12-5-7-19(2)17-29)16-24(25)28-26(30)34-18-21-9-8-20(3)23(27)15-21/h8-11,15-16,19H,4-7,12-14,17-18H2,1-3H3/t19-/m1/s1 |
| InChIKey | DTBGGHDVKCMXFA-LJQANCHMSA-N |
| XLogP | 5.62 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|